About 4-chloro-1,5-dimethylimidazole
4-chloro-1,5-dimethylimidazole (PubChem CID 59999519) has the molecular formula C5H7ClN2
and a molecular weight of 130.58 g/mol. Its IUPAC name is 4-chloro-1,5-dimethylimidazole.
Molecular Properties
| Compound Name | 4-chloro-1,5-dimethylimidazole |
| PubChem CID | 59999519 |
| Molecular Formula | C5H7ClN2 |
| Molecular Weight | 130.58 g/mol |
| Exact Mass | 130.03 |
| IUPAC Name | 4-chloro-1,5-dimethylimidazole |
| SMILES | Cc1c(Cl)ncn1C |
| InChI | InChI=1S/C5H7ClN2/c1-4-5(6)7-3-8(4)2/h3H,1-2H3 |
| InChIKey | QUSFAMRQIOVQSO-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.58 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-chloro-1,5-dimethylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-1,5-dimethylimidazole?
The IUPAC name of 4-chloro-1,5-dimethylimidazole (CID 59999519) is 4-chloro-1,5-dimethylimidazole.
What is the SMILES notation for 4-chloro-1,5-dimethylimidazole?
The canonical SMILES for 4-chloro-1,5-dimethylimidazole is Cc1c(Cl)ncn1C.
What is the InChIKey of 4-chloro-1,5-dimethylimidazole?
The InChIKey is QUSFAMRQIOVQSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7ClN2/c1-4-5(6)7-3-8(4)2/h3H,1-2H3.
What are the key properties of 4-chloro-1,5-dimethylimidazole?
4-chloro-1,5-dimethylimidazole has a molecular weight of 130.58 g/mol, XLogP of 1.38, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-1,5-dimethylimidazole is sourced from PubChem (CID 59999519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).