C36H60N4S4 — CID 59999859
(1S,4R,9R,11S,14R,16S,19R)-5,10,15,20-tetrakis(thiolan-3-yl)-1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,20,21,22,23,24-tetracosahydroporphyrin (PubChem CID 59999859) has the molecular formula C36H60N4S4 and a molecular weight of 677.17 g/mol. Its IUPAC name is (1S,4R,9R,11S,14R,16S,19R)-5,10,15,20-tetrakis(thiolan-3-yl)-1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,20,21,22,23,24-tetracosahydroporphyrin.
| Compound Name | (1S,4R,9R,11S,14R,16S,19R)-5,10,15,20-tetrakis(thiolan-3-yl)-1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,20,21,22,23,24-tetracosahydroporphyrin |
|---|---|
| PubChem CID | 59999859 |
| Molecular Formula | C36H60N4S4 |
| Molecular Weight | 677.17 g/mol |
| Exact Mass | 676.37 |
| IUPAC Name | (1S,4R,9R,11S,14R,16S,19R)-5,10,15,20-tetrakis(thiolan-3-yl)-1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,20,21,22,23,24-tetracosahydroporphyrin |
| SMILES | C1CC(C2C3CC[C@@H](N3)C(C3CCSC3)[C@@H]3CC[C@@H](N3)C(C3CCSC3)[C@@H]3CC[C@@H](N3)C(C3CCSC3)[C@@H]3CC[C@H]2N3)CS1 |
| InChI | InChI=1S/C36H60N4S4/c1-2-26-34(22-10-14-42-18-22)28-5-6-30(39-28)36(24-12-16-44-20-24)32-8-7-31(40-32)35(23-11-15-43-19-23)29-4-3-27(38-29)33(25(1)37-26)21-9-13-41-17-21/h21-40H,1-20H2/t21?,22?,23?,24?,25-,26+,27+,28-,29-,30+,31+,32?,33?,34?,35?,36?/m0/s1 |
| InChIKey | QZHQCYJPJCGJCL-WHXBRZNCSA-N |
| XLogP | 5.96 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.17 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |