About 6-hydroxyhexanoate
6-hydroxyhexanoate (PubChem CID 5460267) has the molecular formula C6H11O3-
and a molecular weight of 131.15 g/mol. Its IUPAC name is 6-hydroxyhexanoate.
Molecular Properties
| Compound Name | 6-hydroxyhexanoate |
| PubChem CID | 5460267 |
| Molecular Formula | C6H11O3- |
| Molecular Weight | 131.15 g/mol |
| Exact Mass | 131.07 |
| IUPAC Name | 6-hydroxyhexanoate |
| SMILES | O=C([O-])CCCCCO |
| InChI | InChI=1S/C6H12O3/c7-5-3-1-2-4-6(8)9/h7H,1-5H2,(H,8,9)/p-1 |
| InChIKey | IWHLYPDWHHPVAA-UHFFFAOYSA-M |
| XLogP | -0.71 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.15 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-hydroxyhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxyhexanoate?
The IUPAC name of 6-hydroxyhexanoate (CID 5460267) is 6-hydroxyhexanoate.
What is the SMILES notation for 6-hydroxyhexanoate?
The canonical SMILES for 6-hydroxyhexanoate is O=C([O-])CCCCCO.
What is the InChIKey of 6-hydroxyhexanoate?
The InChIKey is IWHLYPDWHHPVAA-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H12O3/c7-5-3-1-2-4-6(8)9/h7H,1-5H2,(H,8,9)/p-1.
What are the key properties of 6-hydroxyhexanoate?
6-hydroxyhexanoate has a molecular weight of 131.15 g/mol, XLogP of -0.71, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxyhexanoate is sourced from PubChem (CID 5460267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).