C27H26N6O — CID 6000010
(E)-3-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-(5-morpholin-4-yl-4-phenyl-1,2,4-triazol-3-yl)prop-2-enenitrile (PubChem CID 6000010) has the molecular formula C27H26N6O and a molecular weight of 450.55 g/mol. Its IUPAC name is (E)-3-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-(5-morpholin-4-yl-4-phenyl-1,2,4-triazol-3-yl)prop-2-enenitrile.
| Compound Name | (E)-3-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-(5-morpholin-4-yl-4-phenyl-1,2,4-triazol-3-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 6000010 |
| Molecular Formula | C27H26N6O |
| Molecular Weight | 450.55 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | (E)-3-(2,5-dimethyl-1-phenylpyrrol-3-yl)-2-(5-morpholin-4-yl-4-phenyl-1,2,4-triazol-3-yl)prop-2-enenitrile |
| SMILES | Cc1cc(/C=C(\C#N)c2nnc(N3CCOCC3)n2-c2ccccc2)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C27H26N6O/c1-20-17-22(21(2)32(20)24-9-5-3-6-10-24)18-23(19-28)26-29-30-27(31-13-15-34-16-14-31)33(26)25-11-7-4-8-12-25/h3-12,17-18H,13-16H2,1-2H3/b23-18+ |
| InChIKey | JQXSNNNVMQBHEV-PTGBLXJZSA-N |
| XLogP | 4.58 |
| TPSA | 71.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.55 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|