About 5,5-dimethyl-7-oxo-4,6-dihydro-2-benzothiophene-1,3-dicarbonitrile
5,5-dimethyl-7-oxo-4,6-dihydro-2-benzothiophene-1,3-dicarbonitrile (PubChem CID 600022) has the molecular formula C12H10N2OS
and a molecular weight of 230.29 g/mol. Its IUPAC name is 5,5-dimethyl-7-oxo-4,6-dihydro-2-benzothiophene-1,3-dicarbonitrile.
Molecular Properties
| Compound Name | 5,5-dimethyl-7-oxo-4,6-dihydro-2-benzothiophene-1,3-dicarbonitrile |
| PubChem CID | 600022 |
| Molecular Formula | C12H10N2OS |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 5,5-dimethyl-7-oxo-4,6-dihydro-2-benzothiophene-1,3-dicarbonitrile |
| SMILES | CC1(C)CC(=O)c2c(C#N)sc(C#N)c2C1 |
| InChI | InChI=1S/C12H10N2OS/c1-12(2)3-7-9(5-13)16-10(6-14)11(7)8(15)4-12/h3-4H2,1-2H3 |
| InChIKey | JYHNPSUAHSMKLT-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 64.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,5-dimethyl-7-oxo-4,6-dihydro-2-benzothiophene-1,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyl-7-oxo-4,6-dihydro-2-benzothiophene-1,3-dicarbonitrile?
The IUPAC name of 5,5-dimethyl-7-oxo-4,6-dihydro-2-benzothiophene-1,3-dicarbonitrile (CID 600022) is 5,5-dimethyl-7-oxo-4,6-dihydro-2-benzothiophene-1,3-dicarbonitrile.
What is the SMILES notation for 5,5-dimethyl-7-oxo-4,6-dihydro-2-benzothiophene-1,3-dicarbonitrile?
The canonical SMILES for 5,5-dimethyl-7-oxo-4,6-dihydro-2-benzothiophene-1,3-dicarbonitrile is CC1(C)CC(=O)c2c(C#N)sc(C#N)c2C1.
What is the InChIKey of 5,5-dimethyl-7-oxo-4,6-dihydro-2-benzothiophene-1,3-dicarbonitrile?
The InChIKey is JYHNPSUAHSMKLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2OS/c1-12(2)3-7-9(5-13)16-10(6-14)11(7)8(15)4-12/h3-4H2,1-2H3.
What are the key properties of 5,5-dimethyl-7-oxo-4,6-dihydro-2-benzothiophene-1,3-dicarbonitrile?
5,5-dimethyl-7-oxo-4,6-dihydro-2-benzothiophene-1,3-dicarbonitrile has a molecular weight of 230.29 g/mol, XLogP of 2.65, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-7-oxo-4,6-dihydro-2-benzothiophene-1,3-dicarbonitrile is sourced from PubChem (CID 600022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).