C23H19ClN4O2 — CID 6000891
[4-[(E)-2-cyano-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethenyl]phenyl] 2-chlorobenzoate (PubChem CID 6000891) has the molecular formula C23H19ClN4O2 and a molecular weight of 418.88 g/mol. Its IUPAC name is [4-[(E)-2-cyano-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethenyl]phenyl] 2-chlorobenzoate.
| Compound Name | [4-[(E)-2-cyano-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethenyl]phenyl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 6000891 |
| Molecular Formula | C23H19ClN4O2 |
| Molecular Weight | 418.88 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | [4-[(E)-2-cyano-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)ethenyl]phenyl] 2-chlorobenzoate |
| SMILES | N#C/C(=C\c1ccc(OC(=O)c2ccccc2Cl)cc1)c1nnc2n1CCCCC2 |
| InChI | InChI=1S/C23H19ClN4O2/c24-20-7-4-3-6-19(20)23(29)30-18-11-9-16(10-12-18)14-17(15-25)22-27-26-21-8-2-1-5-13-28(21)22/h3-4,6-7,9-12,14H,1-2,5,8,13H2/b17-14+ |
| InChIKey | XBVQVLUHUHLUOT-SAPNQHFASA-N |
| XLogP | 4.94 |
| TPSA | 80.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.88 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|