About 2-Cyanoethyl ethyl carbonate
2-Cyanoethyl ethyl carbonate (PubChem CID 60012533) has the molecular formula C6H9NO3
and a molecular weight of 143.14 g/mol. Its IUPAC name is 2-cyanoethyl ethyl carbonate.
Molecular Properties
| Compound Name | 2-Cyanoethyl ethyl carbonate |
| PubChem CID | 60012533 |
| Molecular Formula | C6H9NO3 |
| Molecular Weight | 143.14 g/mol |
| Exact Mass | 143.06 |
| IUPAC Name | 2-cyanoethyl ethyl carbonate |
| SMILES | CCOC(=O)OCCC#N |
| InChI | InChI=1S/C6H9NO3/c1-2-9-6(8)10-5-3-4-7/h2-3,5H2,1H3 |
| InChIKey | MVWCONSYGHBPMJ-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 59.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | 146 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.14 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-Cyanoethyl ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-Cyanoethyl ethyl carbonate?
The IUPAC name of 2-Cyanoethyl ethyl carbonate (CID 60012533) is 2-cyanoethyl ethyl carbonate.
What is the SMILES notation for 2-Cyanoethyl ethyl carbonate?
The canonical SMILES for 2-Cyanoethyl ethyl carbonate is CCOC(=O)OCCC#N.
What is the InChIKey of 2-Cyanoethyl ethyl carbonate?
The InChIKey is MVWCONSYGHBPMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO3/c1-2-9-6(8)10-5-3-4-7/h2-3,5H2,1H3.
What are the key properties of 2-Cyanoethyl ethyl carbonate?
2-Cyanoethyl ethyl carbonate has a molecular weight of 143.14 g/mol, XLogP of 0.60, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-Cyanoethyl ethyl carbonate is sourced from PubChem (CID 60012533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).