About [(E)-but-2-enyl] N-phenylcarbamate
[(E)-but-2-enyl] N-phenylcarbamate (PubChem CID 6001964) has the molecular formula C11H13NO2
and a molecular weight of 191.23 g/mol. Its IUPAC name is [(E)-but-2-enyl] N-phenylcarbamate.
Molecular Properties
| Compound Name | [(E)-but-2-enyl] N-phenylcarbamate |
| PubChem CID | 6001964 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | [(E)-but-2-enyl] N-phenylcarbamate |
| SMILES | C/C=C/COC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C11H13NO2/c1-2-3-9-14-11(13)12-10-7-5-4-6-8-10/h2-8H,9H2,1H3,(H,12,13)/b3-2+ |
| InChIKey | XSKLUNLMKNMXFF-NSCUHMNNSA-N |
| XLogP | 2.81 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(E)-but-2-enyl] N-phenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-but-2-enyl] N-phenylcarbamate?
The IUPAC name of [(E)-but-2-enyl] N-phenylcarbamate (CID 6001964) is [(E)-but-2-enyl] N-phenylcarbamate.
What is the SMILES notation for [(E)-but-2-enyl] N-phenylcarbamate?
The canonical SMILES for [(E)-but-2-enyl] N-phenylcarbamate is C/C=C/COC(=O)Nc1ccccc1.
What is the InChIKey of [(E)-but-2-enyl] N-phenylcarbamate?
The InChIKey is XSKLUNLMKNMXFF-NSCUHMNNSA-N. The full InChI is InChI=1S/C11H13NO2/c1-2-3-9-14-11(13)12-10-7-5-4-6-8-10/h2-8H,9H2,1H3,(H,12,13)/b3-2+.
What are the key properties of [(E)-but-2-enyl] N-phenylcarbamate?
[(E)-but-2-enyl] N-phenylcarbamate has a molecular weight of 191.23 g/mol, XLogP of 2.81, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-but-2-enyl] N-phenylcarbamate is sourced from PubChem (CID 6001964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).