C14H22 — CID 600264
3,3,5,6,8,8-hexamethyltricyclo[5.1.0.02,4]oct-5-ene (PubChem CID 600264) has the molecular formula C14H22 and a molecular weight of 190.33 g/mol. Its IUPAC name is 3,3,5,6,8,8-hexamethyltricyclo[5.1.0.02,4]oct-5-ene.
| Compound Name | 3,3,5,6,8,8-hexamethyltricyclo[5.1.0.02,4]oct-5-ene |
|---|---|
| PubChem CID | 600264 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | 3,3,5,6,8,8-hexamethyltricyclo[5.1.0.02,4]oct-5-ene |
| SMILES | CC1=C(C)C2C(C3C1C3(C)C)C2(C)C |
| InChI | InChI=1S/C14H22/c1-7-8(2)10-12(14(10,5)6)11-9(7)13(11,3)4/h9-12H,1-6H3 |
| InChIKey | WXFVNBKWGUKJJX-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|