About N-[(E)-3,4-dihydro-2H-naphthalen-1-ylideneamino]-2-naphthalen-1-ylacetamide
N-[(E)-3,4-dihydro-2H-naphthalen-1-ylideneamino]-2-naphthalen-1-ylacetamide (PubChem CID 6003090) has the molecular formula C22H20N2O
and a molecular weight of 328.42 g/mol. Its IUPAC name is N-[(E)-3,4-dihydro-2H-naphthalen-1-ylideneamino]-2-naphthalen-1-ylacetamide.
Molecular Properties
| Compound Name | N-[(E)-3,4-dihydro-2H-naphthalen-1-ylideneamino]-2-naphthalen-1-ylacetamide |
| PubChem CID | 6003090 |
| Molecular Formula | C22H20N2O |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | N-[(E)-3,4-dihydro-2H-naphthalen-1-ylideneamino]-2-naphthalen-1-ylacetamide |
| SMILES | O=C(Cc1cccc2ccccc12)N/N=C1\CCCc2ccccc21 |
| InChI | InChI=1S/C22H20N2O/c25-22(15-18-11-5-9-16-7-1-3-12-19(16)18)24-23-21-14-6-10-17-8-2-4-13-20(17)21/h1-5,7-9,11-13H,6,10,14-15H2,(H,24,25)/b23-21+ |
| InChIKey | IUVYAJOFMODWQI-XTQSDGFTSA-N |
| XLogP | 4.24 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-3,4-dihydro-2H-naphthalen-1-ylideneamino]-2-naphthalen-1-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-3,4-dihydro-2H-naphthalen-1-ylideneamino]-2-naphthalen-1-ylacetamide?
The IUPAC name of N-[(E)-3,4-dihydro-2H-naphthalen-1-ylideneamino]-2-naphthalen-1-ylacetamide (CID 6003090) is N-[(E)-3,4-dihydro-2H-naphthalen-1-ylideneamino]-2-naphthalen-1-ylacetamide.
What is the SMILES notation for N-[(E)-3,4-dihydro-2H-naphthalen-1-ylideneamino]-2-naphthalen-1-ylacetamide?
The canonical SMILES for N-[(E)-3,4-dihydro-2H-naphthalen-1-ylideneamino]-2-naphthalen-1-ylacetamide is O=C(Cc1cccc2ccccc12)N/N=C1\CCCc2ccccc21.
What is the InChIKey of N-[(E)-3,4-dihydro-2H-naphthalen-1-ylideneamino]-2-naphthalen-1-ylacetamide?
The InChIKey is IUVYAJOFMODWQI-XTQSDGFTSA-N. The full InChI is InChI=1S/C22H20N2O/c25-22(15-18-11-5-9-16-7-1-3-12-19(16)18)24-23-21-14-6-10-17-8-2-4-13-20(17)21/h1-5,7-9,11-13H,6,10,14-15H2,(H,24,25)/b23-21+.
What are the key properties of N-[(E)-3,4-dihydro-2H-naphthalen-1-ylideneamino]-2-naphthalen-1-ylacetamide?
N-[(E)-3,4-dihydro-2H-naphthalen-1-ylideneamino]-2-naphthalen-1-ylacetamide has a molecular weight of 328.42 g/mol, XLogP of 4.24, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-3,4-dihydro-2H-naphthalen-1-ylideneamino]-2-naphthalen-1-ylacetamide is sourced from PubChem (CID 6003090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).