About 5-methoxy-1,2-dimethylindole
5-methoxy-1,2-dimethylindole (PubChem CID 600315) has the molecular formula C11H13NO
and a molecular weight of 175.23 g/mol. Its IUPAC name is 5-methoxy-1,2-dimethylindole.
Molecular Properties
| Compound Name | 5-methoxy-1,2-dimethylindole |
| PubChem CID | 600315 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 5-methoxy-1,2-dimethylindole |
| SMILES | COc1ccc2c(c1)cc(C)n2C |
| InChI | InChI=1S/C11H13NO/c1-8-6-9-7-10(13-3)4-5-11(9)12(8)2/h4-7H,1-3H3 |
| InChIKey | FODAUNMFUIXBBO-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methoxy-1,2-dimethylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-1,2-dimethylindole?
The IUPAC name of 5-methoxy-1,2-dimethylindole (CID 600315) is 5-methoxy-1,2-dimethylindole.
What is the SMILES notation for 5-methoxy-1,2-dimethylindole?
The canonical SMILES for 5-methoxy-1,2-dimethylindole is COc1ccc2c(c1)cc(C)n2C.
What is the InChIKey of 5-methoxy-1,2-dimethylindole?
The InChIKey is FODAUNMFUIXBBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO/c1-8-6-9-7-10(13-3)4-5-11(9)12(8)2/h4-7H,1-3H3.
What are the key properties of 5-methoxy-1,2-dimethylindole?
5-methoxy-1,2-dimethylindole has a molecular weight of 175.23 g/mol, XLogP of 2.50, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-1,2-dimethylindole is sourced from PubChem (CID 600315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).