C14H10ClF2NOS — CID 600363
N-(2-chloro-4,5-difluorophenyl)-3-methylsulfanylbenzamide (PubChem CID 600363) has the molecular formula C14H10ClF2NOS and a molecular weight of 313.76 g/mol. Its IUPAC name is N-(2-chloro-4,5-difluorophenyl)-3-methylsulfanylbenzamide.
| Compound Name | N-(2-chloro-4,5-difluorophenyl)-3-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 600363 |
| Molecular Formula | C14H10ClF2NOS |
| Molecular Weight | 313.76 g/mol |
| Exact Mass | 313.01 |
| IUPAC Name | N-(2-chloro-4,5-difluorophenyl)-3-methylsulfanylbenzamide |
| SMILES | CSc1cccc(C(=O)Nc2cc(F)c(F)cc2Cl)c1 |
| InChI | InChI=1S/C14H10ClF2NOS/c1-20-9-4-2-3-8(5-9)14(19)18-13-7-12(17)11(16)6-10(13)15/h2-7H,1H3,(H,18,19) |
| InChIKey | DXFJURQMGIXEPK-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.76 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|