About 5-methylthiophene-2,4-disulfonamide
5-methylthiophene-2,4-disulfonamide (PubChem CID 600438) has the molecular formula C5H8N2O4S3
and a molecular weight of 256.33 g/mol. Its IUPAC name is 5-methylthiophene-2,4-disulfonamide.
Molecular Properties
| Compound Name | 5-methylthiophene-2,4-disulfonamide |
| PubChem CID | 600438 |
| Molecular Formula | C5H8N2O4S3 |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 255.96 |
| IUPAC Name | 5-methylthiophene-2,4-disulfonamide |
| SMILES | Cc1sc(S(N)(=O)=O)cc1S(N)(=O)=O |
| InChI | InChI=1S/C5H8N2O4S3/c1-3-4(13(6,8)9)2-5(12-3)14(7,10)11/h2H,1H3,(H2,6,8,9)(H2,7,10,11) |
| InChIKey | WGEMYMCGGYWLQB-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-methylthiophene-2,4-disulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylthiophene-2,4-disulfonamide?
The IUPAC name of 5-methylthiophene-2,4-disulfonamide (CID 600438) is 5-methylthiophene-2,4-disulfonamide.
What is the SMILES notation for 5-methylthiophene-2,4-disulfonamide?
The canonical SMILES for 5-methylthiophene-2,4-disulfonamide is Cc1sc(S(N)(=O)=O)cc1S(N)(=O)=O.
What is the InChIKey of 5-methylthiophene-2,4-disulfonamide?
The InChIKey is WGEMYMCGGYWLQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O4S3/c1-3-4(13(6,8)9)2-5(12-3)14(7,10)11/h2H,1H3,(H2,6,8,9)(H2,7,10,11).
What are the key properties of 5-methylthiophene-2,4-disulfonamide?
5-methylthiophene-2,4-disulfonamide has a molecular weight of 256.33 g/mol, XLogP of -0.65, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylthiophene-2,4-disulfonamide is sourced from PubChem (CID 600438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).