C8H6F10N2O2 — CID 600476
2,2,3,3,3-pentafluoro-N-[2-(2,2,3,3,3-pentafluoropropanoylamino)ethyl]propanamide (PubChem CID 600476) has the molecular formula C8H6F10N2O2 and a molecular weight of 352.13 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-N-[2-(2,2,3,3,3-pentafluoropropanoylamino)ethyl]propanamide.
| Compound Name | 2,2,3,3,3-pentafluoro-N-[2-(2,2,3,3,3-pentafluoropropanoylamino)ethyl]propanamide |
|---|---|
| PubChem CID | 600476 |
| Molecular Formula | C8H6F10N2O2 |
| Molecular Weight | 352.13 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-N-[2-(2,2,3,3,3-pentafluoropropanoylamino)ethyl]propanamide |
| SMILES | O=C(NCCNC(=O)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H6F10N2O2/c9-5(10,7(13,14)15)3(21)19-1-2-20-4(22)6(11,12)8(16,17)18/h1-2H2,(H,19,21)(H,20,22) |
| InChIKey | FIYBCTKHPJMSKA-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.13 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|