C14H16N2O2S — CID 6005254
N-[(E)-1-(5-methylthiophen-2-yl)butylideneamino]furan-2-carboxamide (PubChem CID 6005254) has the molecular formula C14H16N2O2S and a molecular weight of 276.36 g/mol. Its IUPAC name is N-[(E)-1-(5-methylthiophen-2-yl)butylideneamino]furan-2-carboxamide.
| Compound Name | N-[(E)-1-(5-methylthiophen-2-yl)butylideneamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 6005254 |
| Molecular Formula | C14H16N2O2S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | N-[(E)-1-(5-methylthiophen-2-yl)butylideneamino]furan-2-carboxamide |
| SMILES | CCC/C(=N\NC(=O)c1ccco1)c1ccc(C)s1 |
| InChI | InChI=1S/C14H16N2O2S/c1-3-5-11(13-8-7-10(2)19-13)15-16-14(17)12-6-4-9-18-12/h4,6-9H,3,5H2,1-2H3,(H,16,17)/b15-11+ |
| InChIKey | UUMPOWFBDKOKMV-RVDMUPIBSA-N |
| XLogP | 3.58 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|