About 4-phenylpyrazolidine-3,5-dione
4-phenylpyrazolidine-3,5-dione (PubChem CID 600567) has the molecular formula C9H8N2O2
and a molecular weight of 176.18 g/mol. Its IUPAC name is 4-phenylpyrazolidine-3,5-dione.
Molecular Properties
| Compound Name | 4-phenylpyrazolidine-3,5-dione |
| PubChem CID | 600567 |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | 4-phenylpyrazolidine-3,5-dione |
| SMILES | O=C1NNC(=O)C1c1ccccc1 |
| InChI | InChI=1S/C9H8N2O2/c12-8-7(9(13)11-10-8)6-4-2-1-3-5-6/h1-5,7H,(H,10,12)(H,11,13) |
| InChIKey | LVPAFBQXTOAGDR-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 4-phenylpyrazolidine-3,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenylpyrazolidine-3,5-dione?
The IUPAC name of 4-phenylpyrazolidine-3,5-dione (CID 600567) is 4-phenylpyrazolidine-3,5-dione.
What is the SMILES notation for 4-phenylpyrazolidine-3,5-dione?
The canonical SMILES for 4-phenylpyrazolidine-3,5-dione is O=C1NNC(=O)C1c1ccccc1.
What is the InChIKey of 4-phenylpyrazolidine-3,5-dione?
The InChIKey is LVPAFBQXTOAGDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O2/c12-8-7(9(13)11-10-8)6-4-2-1-3-5-6/h1-5,7H,(H,10,12)(H,11,13).
What are the key properties of 4-phenylpyrazolidine-3,5-dione?
4-phenylpyrazolidine-3,5-dione has a molecular weight of 176.18 g/mol, XLogP of -0.07, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenylpyrazolidine-3,5-dione is sourced from PubChem (CID 600567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).