C9H8N2O2 — CID 600572
3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione (PubChem CID 600572) has the molecular formula C9H8N2O2 and a molecular weight of 176.18 g/mol. Its IUPAC name is 3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione.
| Compound Name | 3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione |
|---|---|
| PubChem CID | 600572 |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | 3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione |
| SMILES | O=C1CNC(=O)c2ccccc2N1 |
| InChI | InChI=1S/C9H8N2O2/c12-8-5-10-9(13)6-3-1-2-4-7(6)11-8/h1-4H,5H2,(H,10,13)(H,11,12) |
| InChIKey | AZHGGDCFQPMANU-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |