C22H26O10 — CID 6005824
tetramethyl (4Z)-10,13-dioxotricyclo[6.3.3.01,8]tetradec-4-ene-9,11,12,14-tetracarboxylate (PubChem CID 6005824) has the molecular formula C22H26O10 and a molecular weight of 450.44 g/mol. Its IUPAC name is tetramethyl (4Z)-10,13-dioxotricyclo[6.3.3.01,8]tetradec-4-ene-9,11,12,14-tetracarboxylate.
| Compound Name | tetramethyl (4Z)-10,13-dioxotricyclo[6.3.3.01,8]tetradec-4-ene-9,11,12,14-tetracarboxylate |
|---|---|
| PubChem CID | 6005824 |
| Molecular Formula | C22H26O10 |
| Molecular Weight | 450.44 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | tetramethyl (4Z)-10,13-dioxotricyclo[6.3.3.01,8]tetradec-4-ene-9,11,12,14-tetracarboxylate |
| SMILES | COC(=O)C1C(=O)C(C(=O)OC)C23CC/C=C\CCC12C(C(=O)OC)C(=O)C3C(=O)OC |
| InChI | InChI=1S/C22H26O10/c1-29-17(25)11-15(23)12(18(26)30-2)22-10-8-6-5-7-9-21(11,22)13(19(27)31-3)16(24)14(22)20(28)32-4/h5-6,11-14H,7-10H2,1-4H3/b6-5- |
| InChIKey | YXRHIFWDGQBKJK-WAYWQWQTSA-N |
| XLogP | 0.41 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.44 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|