About 4-hydroxy-3H-1,4-benzodiazepin-2-one
4-hydroxy-3H-1,4-benzodiazepin-2-one (PubChem CID 600594) has the molecular formula C9H8N2O2
and a molecular weight of 176.17 g/mol. Its IUPAC name is 4-hydroxy-3H-1,4-benzodiazepin-2-one.
Molecular Properties
| Compound Name | 4-hydroxy-3H-1,4-benzodiazepin-2-one |
| PubChem CID | 600594 |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | 4-hydroxy-3H-1,4-benzodiazepin-2-one |
| SMILES | O=C1CN(O)C=c2ccccc2=N1 |
| InChI | InChI=1S/C9H8N2O2/c12-9-6-11(13)5-7-3-1-2-4-8(7)10-9/h1-5,13H,6H2 |
| InChIKey | ZHTGCABWKDVXQV-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-hydroxy-3H-1,4-benzodiazepin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-3H-1,4-benzodiazepin-2-one?
The IUPAC name of 4-hydroxy-3H-1,4-benzodiazepin-2-one (CID 600594) is 4-hydroxy-3H-1,4-benzodiazepin-2-one.
What is the SMILES notation for 4-hydroxy-3H-1,4-benzodiazepin-2-one?
The canonical SMILES for 4-hydroxy-3H-1,4-benzodiazepin-2-one is O=C1CN(O)C=c2ccccc2=N1.
What is the InChIKey of 4-hydroxy-3H-1,4-benzodiazepin-2-one?
The InChIKey is ZHTGCABWKDVXQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O2/c12-9-6-11(13)5-7-3-1-2-4-8(7)10-9/h1-5,13H,6H2.
What are the key properties of 4-hydroxy-3H-1,4-benzodiazepin-2-one?
4-hydroxy-3H-1,4-benzodiazepin-2-one has a molecular weight of 176.17 g/mol, XLogP of -0.72, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-3H-1,4-benzodiazepin-2-one is sourced from PubChem (CID 600594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).