About 3-(2'-oxospiro[1,3-dioxolane-2,3'-indole]-1'-yl)propanenitrile
3-(2'-oxospiro[1,3-dioxolane-2,3'-indole]-1'-yl)propanenitrile (PubChem CID 600599) has the molecular formula C13H12N2O3
and a molecular weight of 244.25 g/mol. Its IUPAC name is 3-(2'-oxospiro[1,3-dioxolane-2,3'-indole]-1'-yl)propanenitrile.
Molecular Properties
| Compound Name | 3-(2'-oxospiro[1,3-dioxolane-2,3'-indole]-1'-yl)propanenitrile |
| PubChem CID | 600599 |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 3-(2'-oxospiro[1,3-dioxolane-2,3'-indole]-1'-yl)propanenitrile |
| SMILES | N#CCCN1C(=O)C2(OCCO2)c2ccccc21 |
| InChI | InChI=1S/C13H12N2O3/c14-6-3-7-15-11-5-2-1-4-10(11)13(12(15)16)17-8-9-18-13/h1-2,4-5H,3,7-9H2 |
| InChIKey | YCHGSBLEZBFNAF-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 62.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(2'-oxospiro[1,3-dioxolane-2,3'-indole]-1'-yl)propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2'-oxospiro[1,3-dioxolane-2,3'-indole]-1'-yl)propanenitrile?
The IUPAC name of 3-(2'-oxospiro[1,3-dioxolane-2,3'-indole]-1'-yl)propanenitrile (CID 600599) is 3-(2'-oxospiro[1,3-dioxolane-2,3'-indole]-1'-yl)propanenitrile.
What is the SMILES notation for 3-(2'-oxospiro[1,3-dioxolane-2,3'-indole]-1'-yl)propanenitrile?
The canonical SMILES for 3-(2'-oxospiro[1,3-dioxolane-2,3'-indole]-1'-yl)propanenitrile is N#CCCN1C(=O)C2(OCCO2)c2ccccc21.
What is the InChIKey of 3-(2'-oxospiro[1,3-dioxolane-2,3'-indole]-1'-yl)propanenitrile?
The InChIKey is YCHGSBLEZBFNAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O3/c14-6-3-7-15-11-5-2-1-4-10(11)13(12(15)16)17-8-9-18-13/h1-2,4-5H,3,7-9H2.
What are the key properties of 3-(2'-oxospiro[1,3-dioxolane-2,3'-indole]-1'-yl)propanenitrile?
3-(2'-oxospiro[1,3-dioxolane-2,3'-indole]-1'-yl)propanenitrile has a molecular weight of 244.25 g/mol, XLogP of 1.15, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2'-oxospiro[1,3-dioxolane-2,3'-indole]-1'-yl)propanenitrile is sourced from PubChem (CID 600599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).