C14H20O2S — CID 60060351
(3R,6S)-2,3,5-trimethyl-6-phenylsulfanyloxan-4-ol (PubChem CID 60060351) has the molecular formula C14H20O2S and a molecular weight of 252.37 g/mol. Its IUPAC name is (3R,6S)-2,3,5-trimethyl-6-phenylsulfanyloxan-4-ol.
| Compound Name | (3R,6S)-2,3,5-trimethyl-6-phenylsulfanyloxan-4-ol |
|---|---|
| PubChem CID | 60060351 |
| Molecular Formula | C14H20O2S |
| Molecular Weight | 252.37 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | (3R,6S)-2,3,5-trimethyl-6-phenylsulfanyloxan-4-ol |
| SMILES | C[C@H]1C(O[C@H](C(C1O)C)SC2=CC=CC=C2)C |
| InChI | InChI=1S/C14H20O2S/c1-9-11(3)16-14(10(2)13(9)15)17-12-7-5-4-6-8-12/h4-11,13-15H,1-3H3/t9-,10?,11?,13?,14-/m0/s1 |
| InChIKey | VZNSIVMDBBRDLQ-NZYXAWPISA-N |
| XLogP | 3.60 |
| TPSA | 54.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | 240 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.37 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |