C7H10F5NO — CID 600675
N-butyl-2,2,3,3,3-pentafluoropropanamide (PubChem CID 600675) has the molecular formula C7H10F5NO and a molecular weight of 219.15 g/mol. Its IUPAC name is N-butyl-2,2,3,3,3-pentafluoropropanamide.
| Compound Name | N-butyl-2,2,3,3,3-pentafluoropropanamide |
|---|---|
| PubChem CID | 600675 |
| Molecular Formula | C7H10F5NO |
| Molecular Weight | 219.15 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | N-butyl-2,2,3,3,3-pentafluoropropanamide |
| SMILES | CCCCNC(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H10F5NO/c1-2-3-4-13-5(14)6(8,9)7(10,11)12/h2-4H2,1H3,(H,13,14) |
| InChIKey | WWYNROMKWUPSCK-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.15 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|