C14H24 — CID 600873
1,2,5,7-tetramethyladamantane (PubChem CID 600873) has the molecular formula C14H24 and a molecular weight of 192.35 g/mol. Its IUPAC name is 1,2,5,7-tetramethyladamantane.
| Compound Name | 1,2,5,7-tetramethyladamantane |
|---|---|
| PubChem CID | 600873 |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | 1,2,5,7-tetramethyladamantane |
| SMILES | CC1C2CC3(C)CC(C)(C2)CC1(C)C3 |
| InChI | InChI=1S/C14H24/c1-10-11-5-12(2)7-13(3,6-11)9-14(10,4)8-12/h10-11H,5-9H2,1-4H3 |
| InChIKey | HBIKNLNXSSBQCT-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |