C32H24N6O2 — CID 6009700
2-methyl-3-[(Z)-[(2Z)-2-(2-methyl-4-oxoquinazolin-3-yl)imino-1,2-diphenylethylidene]amino]quinazolin-4-one (PubChem CID 6009700) has the molecular formula C32H24N6O2 and a molecular weight of 524.58 g/mol. Its IUPAC name is 2-methyl-3-[(Z)-[(2Z)-2-(2-methyl-4-oxoquinazolin-3-yl)imino-1,2-diphenylethylidene]amino]quinazolin-4-one.
| Compound Name | 2-methyl-3-[(Z)-[(2Z)-2-(2-methyl-4-oxoquinazolin-3-yl)imino-1,2-diphenylethylidene]amino]quinazolin-4-one |
|---|---|
| PubChem CID | 6009700 |
| Molecular Formula | C32H24N6O2 |
| Molecular Weight | 524.58 g/mol |
| Exact Mass | 524.20 |
| IUPAC Name | 2-methyl-3-[(Z)-[(2Z)-2-(2-methyl-4-oxoquinazolin-3-yl)imino-1,2-diphenylethylidene]amino]quinazolin-4-one |
| SMILES | Cc1nc2ccccc2c(=O)n1/N=C(C(=N/n1c(C)nc2ccccc2c1=O)\c1ccccc1)/c1ccccc1 |
| InChI | InChI=1S/C32H24N6O2/c1-21-33-27-19-11-9-17-25(27)31(39)37(21)35-29(23-13-5-3-6-14-23)30(24-15-7-4-8-16-24)36-38-22(2)34-28-20-12-10-18-26(28)32(38)40/h3-20H,1-2H3/b35-29-,36-30- |
| InChIKey | AFEOSGRKMJGDAG-YSVNBZGQSA-N |
| XLogP | 4.93 |
| TPSA | 94.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.58 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|