C10H12N2S — CID 600982
4,5,6,7-tetramethyl-2,1,3-benzothiadiazole (PubChem CID 600982) has the molecular formula C10H12N2S and a molecular weight of 192.29 g/mol. Its IUPAC name is 4,5,6,7-tetramethyl-2,1,3-benzothiadiazole.
| Compound Name | 4,5,6,7-tetramethyl-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 600982 |
| Molecular Formula | C10H12N2S |
| Molecular Weight | 192.29 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | 4,5,6,7-tetramethyl-2,1,3-benzothiadiazole |
| SMILES | Cc1c(C)c(C)c2nsnc2c1C |
| InChI | InChI=1S/C10H12N2S/c1-5-6(2)8(4)10-9(7(5)3)11-13-12-10/h1-4H3 |
| InChIKey | SPDOODVVIKUTCF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.29 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |