About (3Z,5E)-6-(benzenesulfonyl)-2-methyl-3-phenylsulfanylhexa-3,5-dien-2-ol
(3Z,5E)-6-(benzenesulfonyl)-2-methyl-3-phenylsulfanylhexa-3,5-dien-2-ol (PubChem CID 6010473) has the molecular formula C19H20O3S2
and a molecular weight of 360.50 g/mol. Its IUPAC name is (3Z,5E)-6-(benzenesulfonyl)-2-methyl-3-phenylsulfanylhexa-3,5-dien-2-ol.
Molecular Properties
| Compound Name | (3Z,5E)-6-(benzenesulfonyl)-2-methyl-3-phenylsulfanylhexa-3,5-dien-2-ol |
| PubChem CID | 6010473 |
| Molecular Formula | C19H20O3S2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | (3Z,5E)-6-(benzenesulfonyl)-2-methyl-3-phenylsulfanylhexa-3,5-dien-2-ol |
| SMILES | CC(C)(O)/C(=C/C=C/S(=O)(=O)c1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C19H20O3S2/c1-19(2,20)18(23-16-10-5-3-6-11-16)14-9-15-24(21,22)17-12-7-4-8-13-17/h3-15,20H,1-2H3/b15-9+,18-14- |
| InChIKey | YRFYHVQFGQGRFR-IATADAHLSA-N |
| XLogP | 4.42 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z,5E)-6-(benzenesulfonyl)-2-methyl-3-phenylsulfanylhexa-3,5-dien-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z,5E)-6-(benzenesulfonyl)-2-methyl-3-phenylsulfanylhexa-3,5-dien-2-ol?
The IUPAC name of (3Z,5E)-6-(benzenesulfonyl)-2-methyl-3-phenylsulfanylhexa-3,5-dien-2-ol (CID 6010473) is (3Z,5E)-6-(benzenesulfonyl)-2-methyl-3-phenylsulfanylhexa-3,5-dien-2-ol.
What is the SMILES notation for (3Z,5E)-6-(benzenesulfonyl)-2-methyl-3-phenylsulfanylhexa-3,5-dien-2-ol?
The canonical SMILES for (3Z,5E)-6-(benzenesulfonyl)-2-methyl-3-phenylsulfanylhexa-3,5-dien-2-ol is CC(C)(O)/C(=C/C=C/S(=O)(=O)c1ccccc1)Sc1ccccc1.
What is the InChIKey of (3Z,5E)-6-(benzenesulfonyl)-2-methyl-3-phenylsulfanylhexa-3,5-dien-2-ol?
The InChIKey is YRFYHVQFGQGRFR-IATADAHLSA-N. The full InChI is InChI=1S/C19H20O3S2/c1-19(2,20)18(23-16-10-5-3-6-11-16)14-9-15-24(21,22)17-12-7-4-8-13-17/h3-15,20H,1-2H3/b15-9+,18-14-.
What are the key properties of (3Z,5E)-6-(benzenesulfonyl)-2-methyl-3-phenylsulfanylhexa-3,5-dien-2-ol?
(3Z,5E)-6-(benzenesulfonyl)-2-methyl-3-phenylsulfanylhexa-3,5-dien-2-ol has a molecular weight of 360.50 g/mol, XLogP of 4.42, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z,5E)-6-(benzenesulfonyl)-2-methyl-3-phenylsulfanylhexa-3,5-dien-2-ol is sourced from PubChem (CID 6010473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).