C23H17N3O5 — CID 6011138
[4-[(Z)-[(3-nitrobenzoyl)hydrazinylidene]methyl]phenyl] (E)-3-phenylprop-2-enoate (PubChem CID 6011138) has the molecular formula C23H17N3O5 and a molecular weight of 415.41 g/mol. Its IUPAC name is [4-[(Z)-[(3-nitrobenzoyl)hydrazinylidene]methyl]phenyl] (E)-3-phenylprop-2-enoate.
| Compound Name | [4-[(Z)-[(3-nitrobenzoyl)hydrazinylidene]methyl]phenyl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 6011138 |
| Molecular Formula | C23H17N3O5 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | [4-[(Z)-[(3-nitrobenzoyl)hydrazinylidene]methyl]phenyl] (E)-3-phenylprop-2-enoate |
| SMILES | O=C(/C=C/c1ccccc1)Oc1ccc(/C=N\NC(=O)c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C23H17N3O5/c27-22(14-11-17-5-2-1-3-6-17)31-21-12-9-18(10-13-21)16-24-25-23(28)19-7-4-8-20(15-19)26(29)30/h1-16H,(H,25,28)/b14-11+,24-16- |
| InChIKey | YWCSEXJGEWLHEH-VVTYEFPJSA-N |
| XLogP | 3.98 |
| TPSA | 110.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|