About 3-acetyl-2-amino-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one
3-acetyl-2-amino-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one (PubChem CID 601119) has the molecular formula C9H11N3O2
and a molecular weight of 193.21 g/mol. Its IUPAC name is 3-acetyl-2-amino-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one.
Molecular Properties
| Compound Name | 3-acetyl-2-amino-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one |
| PubChem CID | 601119 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 3-acetyl-2-amino-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one |
| SMILES | CC(=O)c1c(N)nc2n(c1=O)CCC2 |
| InChI | InChI=1S/C9H11N3O2/c1-5(13)7-8(10)11-6-3-2-4-12(6)9(7)14/h2-4,10H2,1H3 |
| InChIKey | IBHXMSWJALWNIG-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-acetyl-2-amino-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetyl-2-amino-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one?
The IUPAC name of 3-acetyl-2-amino-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one (CID 601119) is 3-acetyl-2-amino-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one.
What is the SMILES notation for 3-acetyl-2-amino-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one?
The canonical SMILES for 3-acetyl-2-amino-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one is CC(=O)c1c(N)nc2n(c1=O)CCC2.
What is the InChIKey of 3-acetyl-2-amino-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one?
The InChIKey is IBHXMSWJALWNIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O2/c1-5(13)7-8(10)11-6-3-2-4-12(6)9(7)14/h2-4,10H2,1H3.
What are the key properties of 3-acetyl-2-amino-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one?
3-acetyl-2-amino-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one has a molecular weight of 193.21 g/mol, XLogP of -0.03, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetyl-2-amino-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one is sourced from PubChem (CID 601119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).