About 1-phenyl-N-trimethylsilylethanamine
1-phenyl-N-trimethylsilylethanamine (PubChem CID 601126) has the molecular formula C11H19NSi
and a molecular weight of 193.37 g/mol. Its IUPAC name is 1-phenyl-N-trimethylsilylethanamine.
Molecular Properties
| Compound Name | 1-phenyl-N-trimethylsilylethanamine |
| PubChem CID | 601126 |
| Molecular Formula | C11H19NSi |
| Molecular Weight | 193.37 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | 1-phenyl-N-trimethylsilylethanamine |
| SMILES | CC(N[Si](C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C11H19NSi/c1-10(12-13(2,3)4)11-8-6-5-7-9-11/h5-10,12H,1-4H3 |
| InChIKey | OCGAOEVDPUVZCP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.37 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-phenyl-N-trimethylsilylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-N-trimethylsilylethanamine?
The IUPAC name of 1-phenyl-N-trimethylsilylethanamine (CID 601126) is 1-phenyl-N-trimethylsilylethanamine.
What is the SMILES notation for 1-phenyl-N-trimethylsilylethanamine?
The canonical SMILES for 1-phenyl-N-trimethylsilylethanamine is CC(N[Si](C)(C)C)c1ccccc1.
What is the InChIKey of 1-phenyl-N-trimethylsilylethanamine?
The InChIKey is OCGAOEVDPUVZCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NSi/c1-10(12-13(2,3)4)11-8-6-5-7-9-11/h5-10,12H,1-4H3.
What are the key properties of 1-phenyl-N-trimethylsilylethanamine?
1-phenyl-N-trimethylsilylethanamine has a molecular weight of 193.37 g/mol, XLogP of 3.17, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-N-trimethylsilylethanamine is sourced from PubChem (CID 601126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).