About methyl 2-methyl-3-nitrobenzoate
methyl 2-methyl-3-nitrobenzoate (PubChem CID 601165) has the molecular formula C9H9NO4
and a molecular weight of 195.17 g/mol. Its IUPAC name is methyl 2-methyl-3-nitrobenzoate.
Molecular Properties
| Compound Name | methyl 2-methyl-3-nitrobenzoate |
| PubChem CID | 601165 |
| Molecular Formula | C9H9NO4 |
| Molecular Weight | 195.17 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | methyl 2-methyl-3-nitrobenzoate |
| SMILES | COC(=O)c1cccc([N+](=O)[O-])c1C |
| InChI | InChI=1S/C9H9NO4/c1-6-7(9(11)14-2)4-3-5-8(6)10(12)13/h3-5H,1-2H3 |
| InChIKey | CRZGFIMLHZTLGT-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.17 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-methyl-3-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-methyl-3-nitrobenzoate?
The IUPAC name of methyl 2-methyl-3-nitrobenzoate (CID 601165) is methyl 2-methyl-3-nitrobenzoate.
What is the SMILES notation for methyl 2-methyl-3-nitrobenzoate?
The canonical SMILES for methyl 2-methyl-3-nitrobenzoate is COC(=O)c1cccc([N+](=O)[O-])c1C.
What is the InChIKey of methyl 2-methyl-3-nitrobenzoate?
The InChIKey is CRZGFIMLHZTLGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO4/c1-6-7(9(11)14-2)4-3-5-8(6)10(12)13/h3-5H,1-2H3.
What are the key properties of methyl 2-methyl-3-nitrobenzoate?
methyl 2-methyl-3-nitrobenzoate has a molecular weight of 195.17 g/mol, XLogP of 1.69, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methyl-3-nitrobenzoate is sourced from PubChem (CID 601165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).