C29H33NO5 — CID 6011897
(4E)-5-(4-tert-butylphenyl)-4-[hydroxy-(4-prop-2-enoxyphenyl)methylidene]-1-(oxolan-2-ylmethyl)pyrrolidine-2,3-dione (PubChem CID 6011897) has the molecular formula C29H33NO5 and a molecular weight of 475.59 g/mol. Its IUPAC name is (4E)-5-(4-tert-butylphenyl)-4-[hydroxy-(4-prop-2-enoxyphenyl)methylidene]-1-(oxolan-2-ylmethyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-5-(4-tert-butylphenyl)-4-[hydroxy-(4-prop-2-enoxyphenyl)methylidene]-1-(oxolan-2-ylmethyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6011897 |
| Molecular Formula | C29H33NO5 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | (4E)-5-(4-tert-butylphenyl)-4-[hydroxy-(4-prop-2-enoxyphenyl)methylidene]-1-(oxolan-2-ylmethyl)pyrrolidine-2,3-dione |
| SMILES | C=CCOc1ccc(/C(O)=C2\C(=O)C(=O)N(CC3CCCO3)C2c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C29H33NO5/c1-5-16-34-22-14-10-20(11-15-22)26(31)24-25(19-8-12-21(13-9-19)29(2,3)4)30(28(33)27(24)32)18-23-7-6-17-35-23/h5,8-15,23,25,31H,1,6-7,16-18H2,2-4H3/b26-24+ |
| InChIKey | UMFRSBOVFBOKIU-SHHOIMCASA-N |
| XLogP | 5.15 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|