About 2-(2-methylpropyl)-3,5-di(propan-2-yl)-1,2-dihydropyridine
2-(2-methylpropyl)-3,5-di(propan-2-yl)-1,2-dihydropyridine (PubChem CID 601205) has the molecular formula C15H27N
and a molecular weight of 221.39 g/mol. Its IUPAC name is 2-(2-methylpropyl)-3,5-di(propan-2-yl)-1,2-dihydropyridine.
Molecular Properties
| Compound Name | 2-(2-methylpropyl)-3,5-di(propan-2-yl)-1,2-dihydropyridine |
| PubChem CID | 601205 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | 2-(2-methylpropyl)-3,5-di(propan-2-yl)-1,2-dihydropyridine |
| SMILES | CC(C)CC1NC=C(C(C)C)C=C1C(C)C |
| InChI | InChI=1S/C15H27N/c1-10(2)7-15-14(12(5)6)8-13(9-16-15)11(3)4/h8-12,15-16H,7H2,1-6H3 |
| InChIKey | YYFTXQSCZVIWJZ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2-methylpropyl)-3,5-di(propan-2-yl)-1,2-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylpropyl)-3,5-di(propan-2-yl)-1,2-dihydropyridine?
The IUPAC name of 2-(2-methylpropyl)-3,5-di(propan-2-yl)-1,2-dihydropyridine (CID 601205) is 2-(2-methylpropyl)-3,5-di(propan-2-yl)-1,2-dihydropyridine.
What is the SMILES notation for 2-(2-methylpropyl)-3,5-di(propan-2-yl)-1,2-dihydropyridine?
The canonical SMILES for 2-(2-methylpropyl)-3,5-di(propan-2-yl)-1,2-dihydropyridine is CC(C)CC1NC=C(C(C)C)C=C1C(C)C.
What is the InChIKey of 2-(2-methylpropyl)-3,5-di(propan-2-yl)-1,2-dihydropyridine?
The InChIKey is YYFTXQSCZVIWJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27N/c1-10(2)7-15-14(12(5)6)8-13(9-16-15)11(3)4/h8-12,15-16H,7H2,1-6H3.
What are the key properties of 2-(2-methylpropyl)-3,5-di(propan-2-yl)-1,2-dihydropyridine?
2-(2-methylpropyl)-3,5-di(propan-2-yl)-1,2-dihydropyridine has a molecular weight of 221.39 g/mol, XLogP of 4.13, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylpropyl)-3,5-di(propan-2-yl)-1,2-dihydropyridine is sourced from PubChem (CID 601205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).