About 3-(dibutylamino)phenol
3-(dibutylamino)phenol (PubChem CID 601234) has the molecular formula C14H23NO
and a molecular weight of 221.34 g/mol. Its IUPAC name is 3-(dibutylamino)phenol.
Molecular Properties
| Compound Name | 3-(dibutylamino)phenol |
| PubChem CID | 601234 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 3-(dibutylamino)phenol |
| SMILES | CCCCN(CCCC)c1cccc(O)c1 |
| InChI | InChI=1S/C14H23NO/c1-3-5-10-15(11-6-4-2)13-8-7-9-14(16)12-13/h7-9,12,16H,3-6,10-11H2,1-2H3 |
| InChIKey | KHSTZMGCKHBFJX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(dibutylamino)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dibutylamino)phenol?
The IUPAC name of 3-(dibutylamino)phenol (CID 601234) is 3-(dibutylamino)phenol.
What is the SMILES notation for 3-(dibutylamino)phenol?
The canonical SMILES for 3-(dibutylamino)phenol is CCCCN(CCCC)c1cccc(O)c1.
What is the InChIKey of 3-(dibutylamino)phenol?
The InChIKey is KHSTZMGCKHBFJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23NO/c1-3-5-10-15(11-6-4-2)13-8-7-9-14(16)12-13/h7-9,12,16H,3-6,10-11H2,1-2H3.
What are the key properties of 3-(dibutylamino)phenol?
3-(dibutylamino)phenol has a molecular weight of 221.34 g/mol, XLogP of 3.80, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dibutylamino)phenol is sourced from PubChem (CID 601234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).