C32H35NO8 — CID 6013170
(4E)-4-[hydroxy-(2-methyl-4-phenylmethoxyphenyl)methylidene]-1-(3-methoxypropyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 6013170) has the molecular formula C32H35NO8 and a molecular weight of 561.63 g/mol. Its IUPAC name is (4E)-4-[hydroxy-(2-methyl-4-phenylmethoxyphenyl)methylidene]-1-(3-methoxypropyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[hydroxy-(2-methyl-4-phenylmethoxyphenyl)methylidene]-1-(3-methoxypropyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6013170 |
| Molecular Formula | C32H35NO8 |
| Molecular Weight | 561.63 g/mol |
| Exact Mass | 561.24 |
| IUPAC Name | (4E)-4-[hydroxy-(2-methyl-4-phenylmethoxyphenyl)methylidene]-1-(3-methoxypropyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | COCCCN1C(=O)C(=O)/C(=C(/O)c2ccc(OCc3ccccc3)cc2C)C1c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C32H35NO8/c1-20-16-23(41-19-21-10-7-6-8-11-21)12-13-24(20)29(34)27-28(33(14-9-15-37-2)32(36)30(27)35)22-17-25(38-3)31(40-5)26(18-22)39-4/h6-8,10-13,16-18,28,34H,9,14-15,19H2,1-5H3/b29-27+ |
| InChIKey | KYZBGBZPQQZZMD-ORIPQNMZSA-N |
| XLogP | 5.06 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.63 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|