About 2-methyl-4,5,6,7-tetrahydro-1-benzofuran-3-carboxamide
2-methyl-4,5,6,7-tetrahydro-1-benzofuran-3-carboxamide (PubChem CID 601519) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is 2-methyl-4,5,6,7-tetrahydro-1-benzofuran-3-carboxamide.
Analyze 2-methyl-4,5,6,7-tetrahydro-1-benzofuran-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4,5,6,7-tetrahydro-1-benzofuran-3-carboxamide?
The IUPAC name of 2-methyl-4,5,6,7-tetrahydro-1-benzofuran-3-carboxamide (CID 601519) is 2-methyl-4,5,6,7-tetrahydro-1-benzofuran-3-carboxamide.
What is the SMILES notation for 2-methyl-4,5,6,7-tetrahydro-1-benzofuran-3-carboxamide?
The canonical SMILES for 2-methyl-4,5,6,7-tetrahydro-1-benzofuran-3-carboxamide is Cc1oc2c(c1C(N)=O)CCCC2.
What is the InChIKey of 2-methyl-4,5,6,7-tetrahydro-1-benzofuran-3-carboxamide?
The InChIKey is GMJIQWWDVPHGSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2/c1-6-9(10(11)12)7-4-2-3-5-8(7)13-6/h2-5H2,1H3,(H2,11,12).
What are the key properties of 2-methyl-4,5,6,7-tetrahydro-1-benzofuran-3-carboxamide?
2-methyl-4,5,6,7-tetrahydro-1-benzofuran-3-carboxamide has a molecular weight of 179.22 g/mol, XLogP of 1.57, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4,5,6,7-tetrahydro-1-benzofuran-3-carboxamide is sourced from PubChem (CID 601519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).