C28H29N3O — CID 6015299
(Z)-N-[1-(1-adamantyl)pyrazol-3-yl]-2,3-diphenylprop-2-enamide (PubChem CID 6015299) has the molecular formula C28H29N3O and a molecular weight of 423.56 g/mol. Its IUPAC name is (Z)-N-[1-(1-adamantyl)pyrazol-3-yl]-2,3-diphenylprop-2-enamide.
| Compound Name | (Z)-N-[1-(1-adamantyl)pyrazol-3-yl]-2,3-diphenylprop-2-enamide |
|---|---|
| PubChem CID | 6015299 |
| Molecular Formula | C28H29N3O |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | (Z)-N-[1-(1-adamantyl)pyrazol-3-yl]-2,3-diphenylprop-2-enamide |
| SMILES | O=C(Nc1ccn(C23CC4CC(CC(C4)C2)C3)n1)/C(=C\c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H29N3O/c32-27(25(24-9-5-2-6-10-24)16-20-7-3-1-4-8-20)29-26-11-12-31(30-26)28-17-21-13-22(18-28)15-23(14-21)19-28/h1-12,16,21-23H,13-15,17-19H2,(H,29,30,32)/b25-16- |
| InChIKey | NHVSDJAFDFDTJJ-XYGWBWBKSA-N |
| XLogP | 5.99 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|