About 1-isocyanato-2,4-dimethoxybenzene
1-isocyanato-2,4-dimethoxybenzene (PubChem CID 601637) has the molecular formula C9H9NO3
and a molecular weight of 179.17 g/mol. Its IUPAC name is 1-isocyanato-2,4-dimethoxybenzene.
Molecular Properties
| Compound Name | 1-isocyanato-2,4-dimethoxybenzene |
| PubChem CID | 601637 |
| Molecular Formula | C9H9NO3 |
| Molecular Weight | 179.17 g/mol |
| Exact Mass | 179.06 |
| IUPAC Name | 1-isocyanato-2,4-dimethoxybenzene |
| SMILES | COc1ccc(N=C=O)c(OC)c1 |
| InChI | InChI=1S/C9H9NO3/c1-12-7-3-4-8(10-6-11)9(5-7)13-2/h3-5H,1-2H3 |
| InChIKey | WRAZHLRMDRTLOZ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.17 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 1-isocyanato-2,4-dimethoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-isocyanato-2,4-dimethoxybenzene?
The IUPAC name of 1-isocyanato-2,4-dimethoxybenzene (CID 601637) is 1-isocyanato-2,4-dimethoxybenzene.
What is the SMILES notation for 1-isocyanato-2,4-dimethoxybenzene?
The canonical SMILES for 1-isocyanato-2,4-dimethoxybenzene is COc1ccc(N=C=O)c(OC)c1.
What is the InChIKey of 1-isocyanato-2,4-dimethoxybenzene?
The InChIKey is WRAZHLRMDRTLOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO3/c1-12-7-3-4-8(10-6-11)9(5-7)13-2/h3-5H,1-2H3.
What are the key properties of 1-isocyanato-2,4-dimethoxybenzene?
1-isocyanato-2,4-dimethoxybenzene has a molecular weight of 179.17 g/mol, XLogP of 1.67, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-isocyanato-2,4-dimethoxybenzene is sourced from PubChem (CID 601637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).