C4H2Cl6 — CID 601666
1,1,3,3,4,4-hexachlorobut-1-ene (PubChem CID 601666) has the molecular formula C4H2Cl6 and a molecular weight of 262.78 g/mol. Its IUPAC name is 1,1,3,3,4,4-hexachlorobut-1-ene.
| Compound Name | 1,1,3,3,4,4-hexachlorobut-1-ene |
|---|---|
| PubChem CID | 601666 |
| Molecular Formula | C4H2Cl6 |
| Molecular Weight | 262.78 g/mol |
| Exact Mass | 259.83 |
| IUPAC Name | 1,1,3,3,4,4-hexachlorobut-1-ene |
| SMILES | ClC(Cl)=CC(Cl)(Cl)C(Cl)Cl |
| InChI | InChI=1S/C4H2Cl6/c5-2(6)1-4(9,10)3(7)8/h1,3H |
| InChIKey | ABMSWFCHXPNDHQ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.78 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|