About (2E)-N-(3-aminopropyl)-3,7-dimethylocta-2,6-dienamide
(2E)-N-(3-aminopropyl)-3,7-dimethylocta-2,6-dienamide (PubChem CID 60168428) has the molecular formula C13H24N2O
and a molecular weight of 224.34 g/mol. Its IUPAC name is (2E)-N-(3-aminopropyl)-3,7-dimethylocta-2,6-dienamide.
Molecular Properties
| Compound Name | (2E)-N-(3-aminopropyl)-3,7-dimethylocta-2,6-dienamide |
| PubChem CID | 60168428 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | (2E)-N-(3-aminopropyl)-3,7-dimethylocta-2,6-dienamide |
| SMILES | CC(=CCC/C(=C/C(=O)NCCCN)/C)C |
| InChI | InChI=1S/C13H24N2O/c1-11(2)6-4-7-12(3)10-13(16)15-9-5-8-14/h6,10H,4-5,7-9,14H2,1-3H3,(H,15,16)/b12-10+ |
| InChIKey | NTSYFSQEWWKRRK-ZRDIBKRKSA-N |
| XLogP | 2.30 |
| TPSA | 55.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | 263 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2E)-N-(3-aminopropyl)-3,7-dimethylocta-2,6-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-N-(3-aminopropyl)-3,7-dimethylocta-2,6-dienamide?
The IUPAC name of (2E)-N-(3-aminopropyl)-3,7-dimethylocta-2,6-dienamide (CID 60168428) is (2E)-N-(3-aminopropyl)-3,7-dimethylocta-2,6-dienamide.
What is the SMILES notation for (2E)-N-(3-aminopropyl)-3,7-dimethylocta-2,6-dienamide?
The canonical SMILES for (2E)-N-(3-aminopropyl)-3,7-dimethylocta-2,6-dienamide is CC(=CCC/C(=C/C(=O)NCCCN)/C)C.
What is the InChIKey of (2E)-N-(3-aminopropyl)-3,7-dimethylocta-2,6-dienamide?
The InChIKey is NTSYFSQEWWKRRK-ZRDIBKRKSA-N. The full InChI is InChI=1S/C13H24N2O/c1-11(2)6-4-7-12(3)10-13(16)15-9-5-8-14/h6,10H,4-5,7-9,14H2,1-3H3,(H,15,16)/b12-10+.
What are the key properties of (2E)-N-(3-aminopropyl)-3,7-dimethylocta-2,6-dienamide?
(2E)-N-(3-aminopropyl)-3,7-dimethylocta-2,6-dienamide has a molecular weight of 224.34 g/mol, XLogP of 2.30, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-N-(3-aminopropyl)-3,7-dimethylocta-2,6-dienamide is sourced from PubChem (CID 60168428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).