About benzo[g]isoquinoline
benzo[g]isoquinoline (PubChem CID 601692) has the molecular formula C13H9N
and a molecular weight of 179.22 g/mol. Its IUPAC name is benzo[g]isoquinoline.
Molecular Properties
| Compound Name | benzo[g]isoquinoline |
| PubChem CID | 601692 |
| Molecular Formula | C13H9N |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | benzo[g]isoquinoline |
| SMILES | c1ccc2cc3cnccc3cc2c1 |
| InChI | InChI=1S/C13H9N/c1-2-4-11-8-13-9-14-6-5-12(13)7-10(11)3-1/h1-9H |
| InChIKey | JWMUHTIFNGYNFA-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze benzo[g]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[g]isoquinoline?
The IUPAC name of benzo[g]isoquinoline (CID 601692) is benzo[g]isoquinoline.
What is the SMILES notation for benzo[g]isoquinoline?
The canonical SMILES for benzo[g]isoquinoline is c1ccc2cc3cnccc3cc2c1.
What is the InChIKey of benzo[g]isoquinoline?
The InChIKey is JWMUHTIFNGYNFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9N/c1-2-4-11-8-13-9-14-6-5-12(13)7-10(11)3-1/h1-9H.
What are the key properties of benzo[g]isoquinoline?
benzo[g]isoquinoline has a molecular weight of 179.22 g/mol, XLogP of 3.39, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[g]isoquinoline is sourced from PubChem (CID 601692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).