C23H24N2O3 — CID 6017095
(E)-3-(1,3-benzodioxol-5-yl)-1-(2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl)prop-2-en-1-one (PubChem CID 6017095) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-1-(2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-1-(2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 6017095 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-1-(2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indol-5-yl)prop-2-en-1-one |
| SMILES | Cc1ccc2c(c1)C1CN(C)CCC1N2C(=O)/C=C/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H24N2O3/c1-15-3-6-19-17(11-15)18-13-24(2)10-9-20(18)25(19)23(26)8-5-16-4-7-21-22(12-16)28-14-27-21/h3-8,11-12,18,20H,9-10,13-14H2,1-2H3/b8-5+ |
| InChIKey | VUIXTBRWDAFYBJ-VMPITWQZSA-N |
| XLogP | 3.57 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|