About (2E,6E)-2,6-bis(pyridin-4-ylmethylidene)cyclohexan-1-one
(2E,6E)-2,6-bis(pyridin-4-ylmethylidene)cyclohexan-1-one (PubChem CID 6018993) has the molecular formula C18H16N2O
and a molecular weight of 276.34 g/mol. Its IUPAC name is (2E,6E)-2,6-bis(pyridin-4-ylmethylidene)cyclohexan-1-one.
Molecular Properties
| Compound Name | (2E,6E)-2,6-bis(pyridin-4-ylmethylidene)cyclohexan-1-one |
| PubChem CID | 6018993 |
| Molecular Formula | C18H16N2O |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | (2E,6E)-2,6-bis(pyridin-4-ylmethylidene)cyclohexan-1-one |
| SMILES | O=C1/C(=C/c2ccncc2)CCC/C1=C\c1ccncc1 |
| InChI | InChI=1S/C18H16N2O/c21-18-16(12-14-4-8-19-9-5-14)2-1-3-17(18)13-15-6-10-20-11-7-15/h4-13H,1-3H2/b16-12+,17-13+ |
| InChIKey | CYVVJSKZRBZHAV-UNZYHPAISA-N |
| XLogP | 3.70 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2E,6E)-2,6-bis(pyridin-4-ylmethylidene)cyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,6E)-2,6-bis(pyridin-4-ylmethylidene)cyclohexan-1-one?
The IUPAC name of (2E,6E)-2,6-bis(pyridin-4-ylmethylidene)cyclohexan-1-one (CID 6018993) is (2E,6E)-2,6-bis(pyridin-4-ylmethylidene)cyclohexan-1-one.
What is the SMILES notation for (2E,6E)-2,6-bis(pyridin-4-ylmethylidene)cyclohexan-1-one?
The canonical SMILES for (2E,6E)-2,6-bis(pyridin-4-ylmethylidene)cyclohexan-1-one is O=C1/C(=C/c2ccncc2)CCC/C1=C\c1ccncc1.
What is the InChIKey of (2E,6E)-2,6-bis(pyridin-4-ylmethylidene)cyclohexan-1-one?
The InChIKey is CYVVJSKZRBZHAV-UNZYHPAISA-N. The full InChI is InChI=1S/C18H16N2O/c21-18-16(12-14-4-8-19-9-5-14)2-1-3-17(18)13-15-6-10-20-11-7-15/h4-13H,1-3H2/b16-12+,17-13+.
What are the key properties of (2E,6E)-2,6-bis(pyridin-4-ylmethylidene)cyclohexan-1-one?
(2E,6E)-2,6-bis(pyridin-4-ylmethylidene)cyclohexan-1-one has a molecular weight of 276.34 g/mol, XLogP of 3.70, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,6E)-2,6-bis(pyridin-4-ylmethylidene)cyclohexan-1-one is sourced from PubChem (CID 6018993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).