About 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;hydrochloride
4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;hydrochloride (PubChem CID 6019) has the molecular formula C8H12ClNO3
and a molecular weight of 205.64 g/mol. Its IUPAC name is 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;hydrochloride.
Molecular Properties
| Compound Name | 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;hydrochloride |
| PubChem CID | 6019 |
| Molecular Formula | C8H12ClNO3 |
| Molecular Weight | 205.64 g/mol |
| Exact Mass | 205.05 |
| IUPAC Name | 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;hydrochloride |
| SMILES | Cc1ncc(CO)c(CO)c1O.Cl |
| InChI | InChI=1S/C8H11NO3.ClH/c1-5-8(12)7(4-11)6(3-10)2-9-5;/h2,10-12H,3-4H2,1H3;1H |
| InChIKey | ZUFQODAHGAHPFQ-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.64 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;hydrochloride?
The IUPAC name of 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;hydrochloride (CID 6019) is 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;hydrochloride.
What is the SMILES notation for 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;hydrochloride?
The canonical SMILES for 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;hydrochloride is Cc1ncc(CO)c(CO)c1O.Cl.
What is the InChIKey of 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;hydrochloride?
The InChIKey is ZUFQODAHGAHPFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO3.ClH/c1-5-8(12)7(4-11)6(3-10)2-9-5;/h2,10-12H,3-4H2,1H3;1H.
What are the key properties of 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;hydrochloride?
4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;hydrochloride has a molecular weight of 205.64 g/mol, XLogP of 0.50, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-bis(hydroxymethyl)-2-methylpyridin-3-ol;hydrochloride is sourced from PubChem (CID 6019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).