C17H11N3O7 — CID 6019057
(4E)-2-(3,5-dinitrophenyl)-4-[(2-methoxyphenyl)methylidene]-1,3-oxazol-5-one (PubChem CID 6019057) has the molecular formula C17H11N3O7 and a molecular weight of 369.29 g/mol. Its IUPAC name is (4E)-2-(3,5-dinitrophenyl)-4-[(2-methoxyphenyl)methylidene]-1,3-oxazol-5-one.
| Compound Name | (4E)-2-(3,5-dinitrophenyl)-4-[(2-methoxyphenyl)methylidene]-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 6019057 |
| Molecular Formula | C17H11N3O7 |
| Molecular Weight | 369.29 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | (4E)-2-(3,5-dinitrophenyl)-4-[(2-methoxyphenyl)methylidene]-1,3-oxazol-5-one |
| SMILES | COc1ccccc1/C=C1/N=C(c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)OC1=O |
| InChI | InChI=1S/C17H11N3O7/c1-26-15-5-3-2-4-10(15)8-14-17(21)27-16(18-14)11-6-12(19(22)23)9-13(7-11)20(24)25/h2-9H,1H3/b14-8+ |
| InChIKey | RGLHYWCEJKSGKZ-RIYZIHGNSA-N |
| XLogP | 2.86 |
| TPSA | 134.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.29 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|