C23H24N2O2 — CID 60202645
5-benzyl-6-(4-phenylcyclohexyl)-1H-pyrimidine-2,4-dione (PubChem CID 60202645) has the molecular formula C23H24N2O2 and a molecular weight of 360.40 g/mol. Its IUPAC name is 5-benzyl-6-(4-phenylcyclohexyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 5-benzyl-6-(4-phenylcyclohexyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 60202645 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 5-benzyl-6-(4-phenylcyclohexyl)-1H-pyrimidine-2,4-dione |
| SMILES | C1CC(CCC1C2=CC=CC=C2)C3=C(C(=O)NC(=O)N3)CC4=CC=CC=C4 |
| InChI | InChI=1S/C23H24N2O2/c26-22-20(15-16-7-3-1-4-8-16)21(24-23(27)25-22)19-13-11-18(12-14-19)17-9-5-2-6-10-17/h1-10,18-19H,11-15H2,(H2,24,25,26,27) |
| InChIKey | VHLMQIRJBBXPBJ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | 577 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |