C17H15NO2 — CID 602055
6-methyl-2,2-diphenyl-3H-1,3-oxazin-4-one (PubChem CID 602055) has the molecular formula C17H15NO2 and a molecular weight of 265.31 g/mol. Its IUPAC name is 6-methyl-2,2-diphenyl-3H-1,3-oxazin-4-one.
| Compound Name | 6-methyl-2,2-diphenyl-3H-1,3-oxazin-4-one |
|---|---|
| PubChem CID | 602055 |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 6-methyl-2,2-diphenyl-3H-1,3-oxazin-4-one |
| SMILES | CC1=CC(=O)NC(c2ccccc2)(c2ccccc2)O1 |
| InChI | InChI=1S/C17H15NO2/c1-13-12-16(19)18-17(20-13,14-8-4-2-5-9-14)15-10-6-3-7-11-15/h2-12H,1H3,(H,18,19) |
| InChIKey | VQZQDSLEZXWZHZ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |