C15H29N — CID 602057
2,5-dipropyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline (PubChem CID 602057) has the molecular formula C15H29N and a molecular weight of 223.40 g/mol. Its IUPAC name is 2,5-dipropyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline.
| Compound Name | 2,5-dipropyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline |
|---|---|
| PubChem CID | 602057 |
| Molecular Formula | C15H29N |
| Molecular Weight | 223.40 g/mol |
| Exact Mass | 223.23 |
| IUPAC Name | 2,5-dipropyl-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoline |
| SMILES | CCCC1CCC2C(CCC)CCCC2N1 |
| InChI | InChI=1S/C15H29N/c1-3-6-12-8-5-9-15-14(12)11-10-13(16-15)7-4-2/h12-16H,3-11H2,1-2H3 |
| InChIKey | MPLWFJRXBSAKCA-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.40 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |