About 1-bromo-2-ethynylbenzene
1-bromo-2-ethynylbenzene (PubChem CID 602067) has the molecular formula C8H5Br
and a molecular weight of 181.03 g/mol. Its IUPAC name is 1-bromo-2-ethynylbenzene.
Molecular Properties
| Compound Name | 1-bromo-2-ethynylbenzene |
| PubChem CID | 602067 |
| Molecular Formula | C8H5Br |
| Molecular Weight | 181.03 g/mol |
| Exact Mass | 179.96 |
| IUPAC Name | 1-bromo-2-ethynylbenzene |
| SMILES | C#Cc1ccccc1Br |
| InChI | InChI=1S/C8H5Br/c1-2-7-5-3-4-6-8(7)9/h1,3-6H |
| InChIKey | RVDOYUFNRDGYGU-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.03 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-2-ethynylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2-ethynylbenzene?
The IUPAC name of 1-bromo-2-ethynylbenzene (CID 602067) is 1-bromo-2-ethynylbenzene.
What is the SMILES notation for 1-bromo-2-ethynylbenzene?
The canonical SMILES for 1-bromo-2-ethynylbenzene is C#Cc1ccccc1Br.
What is the InChIKey of 1-bromo-2-ethynylbenzene?
The InChIKey is RVDOYUFNRDGYGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5Br/c1-2-7-5-3-4-6-8(7)9/h1,3-6H.
What are the key properties of 1-bromo-2-ethynylbenzene?
1-bromo-2-ethynylbenzene has a molecular weight of 181.03 g/mol, XLogP of 2.43, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2-ethynylbenzene is sourced from PubChem (CID 602067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).