C28H22O2 — CID 6021352
(1E,4E)-1-[4-[(1E,4E)-3-oxo-5-phenylpenta-1,4-dienyl]phenyl]-5-phenylpenta-1,4-dien-3-one (PubChem CID 6021352) has the molecular formula C28H22O2 and a molecular weight of 390.48 g/mol. Its IUPAC name is (1E,4E)-1-[4-[(1E,4E)-3-oxo-5-phenylpenta-1,4-dienyl]phenyl]-5-phenylpenta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1-[4-[(1E,4E)-3-oxo-5-phenylpenta-1,4-dienyl]phenyl]-5-phenylpenta-1,4-dien-3-one |
|---|---|
| PubChem CID | 6021352 |
| Molecular Formula | C28H22O2 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | (1E,4E)-1-[4-[(1E,4E)-3-oxo-5-phenylpenta-1,4-dienyl]phenyl]-5-phenylpenta-1,4-dien-3-one |
| SMILES | O=C(/C=C/c1ccccc1)/C=C/c1ccc(/C=C/C(=O)/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C28H22O2/c29-27(19-15-23-7-3-1-4-8-23)21-17-25-11-13-26(14-12-25)18-22-28(30)20-16-24-9-5-2-6-10-24/h1-22H/b19-15+,20-16+,21-17+,22-18+ |
| InChIKey | AHEKEFUUCDXYPS-INFGCDKVSA-N |
| XLogP | 6.28 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|