About N-(5-methyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-ylidene)hydroxylamine
N-(5-methyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-ylidene)hydroxylamine (PubChem CID 602181) has the molecular formula C9H15N3O
and a molecular weight of 181.24 g/mol. Its IUPAC name is N-(5-methyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-ylidene)hydroxylamine.
Molecular Properties
| Compound Name | N-(5-methyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-ylidene)hydroxylamine |
| PubChem CID | 602181 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | N-(5-methyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-ylidene)hydroxylamine |
| SMILES | CC12CN3CC(CN(C3)C1)C2=NO |
| InChI | InChI=1S/C9H15N3O/c1-9-4-11-2-7(8(9)10-13)3-12(5-9)6-11/h7,13H,2-6H2,1H3 |
| InChIKey | OWOVOWIYBZMAKV-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 39.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(5-methyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-ylidene)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-methyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-ylidene)hydroxylamine?
The IUPAC name of N-(5-methyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-ylidene)hydroxylamine (CID 602181) is N-(5-methyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-ylidene)hydroxylamine.
What is the SMILES notation for N-(5-methyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-ylidene)hydroxylamine?
The canonical SMILES for N-(5-methyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-ylidene)hydroxylamine is CC12CN3CC(CN(C3)C1)C2=NO.
What is the InChIKey of N-(5-methyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-ylidene)hydroxylamine?
The InChIKey is OWOVOWIYBZMAKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O/c1-9-4-11-2-7(8(9)10-13)3-12(5-9)6-11/h7,13H,2-6H2,1H3.
What are the key properties of N-(5-methyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-ylidene)hydroxylamine?
N-(5-methyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-ylidene)hydroxylamine has a molecular weight of 181.24 g/mol, XLogP of 0.04, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-methyl-1,3-diazatricyclo[3.3.1.13,7]decan-6-ylidene)hydroxylamine is sourced from PubChem (CID 602181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).